Products 1055361-93-7
CAS 1055361-93-7 is the registry number for N-(3-Azidopropyl)-1-pyrenebutanamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg.
N-(3-azidopropyl)-4-pyren-1-ylbutanamide (CAS 1055361-93-7) is a chemical compound with the molecular formula C23H22N4O and a molecular weight of 370.4 g/mol. IUPAC name: N-(3-azidopropyl)-4-pyren-1-ylbutanamide. InChIKey: BFKZFXLTOFLVKF-UHFFFAOYSA-N.
| Molecular formula | C23H22N4O |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | N-(3-azidopropyl)-4-pyren-1-ylbutanamide |
| InChIKey | BFKZFXLTOFLVKF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCC(=O)NCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)