Products 2945955-27-9
CAS 2945955-27-9 is the registry number for nNOS-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[[3-[(pyridin-2-ylmethylamino)methyl]phenoxy]methyl]quinolin-2-amine (CAS 2945955-27-9) is a chemical compound with the molecular formula C23H22N4O and a molecular weight of 370.4 g/mol. IUPAC name: 7-[[3-[(pyridin-2-ylmethylamino)methyl]phenoxy]methyl]quinolin-2-amine. InChIKey: MZJVFMHLRQGSTA-UHFFFAOYSA-N.
| Molecular formula | C23H22N4O |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 7-[[3-[(pyridin-2-ylmethylamino)methyl]phenoxy]methyl]quinolin-2-amine |
| InChIKey | MZJVFMHLRQGSTA-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNCC2=CC(=CC=C2)OCC3=CC4=C(C=C3)C=CC(=N4)N |
Computed by PubChem (NCBI)