Products 862810-50-2

CAS 862810-50-2 is the registry number for PVP-037. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg.

Structural formula: {0} (CAS {1})

N-(5-imidazo[1,2-a]pyrimidin-2-yl-2-methylphenyl)-2-phenylbutanamide (CAS 862810-50-2) is a chemical compound with the molecular formula C23H22N4O and a molecular weight of 370.4 g/mol. IUPAC name: N-(5-imidazo[1,2-a]pyrimidin-2-yl-2-methylphenyl)-2-phenylbutanamide. InChIKey: MMKVSTHRRPPGIO-UHFFFAOYSA-N.

Identity
Molecular formulaC23H22N4O
Molecular weight370.4 g/mol
IUPAC nameN-(5-imidazo[1,2-a]pyrimidin-2-yl-2-methylphenyl)-2-phenylbutanamide
InChIKeyMMKVSTHRRPPGIO-UHFFFAOYSA-N
SMILESCCC(C1=CC=CC=C1)C(=O)NC2=C(C=CC(=C2)C3=CN4C=CC=NC4=N3)C

Computed by PubChem (NCBI)