CAS 10557-74-1 appears in our catalog under these names: 3-Bromo-5-phenyl-1,2-oxazole, 98%, 3-Bromo-5-phenylisoxazole, 98%, 3–Bromo–5–phenyl–1,2–oxazole. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg.
3-bromo-5-phenyl-1,2-oxazole (CAS 10557-74-1) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 3-bromo-5-phenyl-1,2-oxazole. InChIKey: SMWZGZIZOHNWBH-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 3-bromo-5-phenyl-1,2-oxazole |
| InChIKey | SMWZGZIZOHNWBH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NO2)Br |
Computed by PubChem (NCBI)