CAS 105591-10-4 appears in our catalog under these names: L–Serine–d3, L-Serine-2,3,3-d3, 98 atom % D, min 98% Chemical Purity, L-Serine-2,3,3-d3, >95% (HPLC), L-Serine-2,3,3-d3, L-Serine-d3, 99.75%. Offered by: GLPBio, CDN, TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 0,5g, 0,1g, 50mg, 5mg, 250mg, 100mg, 500mg.
(2S)-2-amino-2,3,3-trideuterio-3-hydroxypropanoic acid (CAS 105591-10-4) is a chemical compound with the molecular formula C3H7NO3 and a molecular weight of 108.11 g/mol. IUPAC name: (2S)-2-amino-2,3,3-trideuterio-3-hydroxypropanoic acid. InChIKey: MTCFGRXMJLQNBG-RBXBQAPRSA-N.
| Molecular formula | C3H7NO3 |
|---|---|
| Molecular weight | 108.11 g/mol |
| IUPAC name | (2S)-2-amino-2,3,3-trideuterio-3-hydroxypropanoic acid |
| InChIKey | MTCFGRXMJLQNBG-RBXBQAPRSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])O)N |
Computed by PubChem (NCBI)