CAS 935275-35-7 appears in our catalog under these names: L-Serine-d7, 98 atom % D, min 98% Chemical Purity, L-Serine-d7, >95% (HPLC), L–Serine–d7, L-Serine-d7, 99.97%. Offered by: CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 1mg, 2mg, 25mg, 5mg, 50mg.
Deuterio (2S)-2,3,3-trideuterio-3-deuteriooxy-2-(dideuterioamino)propanoate (CAS 935275-35-7) is a chemical compound with the molecular formula C3H7NO3 and a molecular weight of 112.14 g/mol. IUPAC name: deuterio (2S)-2,3,3-trideuterio-3-deuteriooxy-2-(dideuterioamino)propanoate. InChIKey: MTCFGRXMJLQNBG-DTZHYFPHSA-N.
| Molecular formula | C3H7NO3 |
|---|---|
| Molecular weight | 112.14 g/mol |
| IUPAC name | deuterio (2S)-2,3,3-trideuterio-3-deuteriooxy-2-(dideuterioamino)propanoate |
| InChIKey | MTCFGRXMJLQNBG-DTZHYFPHSA-N |
| SMILES | [2H][C@@](C(=O)O[2H])(C([2H])([2H])O[2H])N([2H])[2H] |
Computed by PubChem (NCBI)