Products 1414348-52-9
CAS 1414348-52-9 appears in our catalog under these names: D-Serine-2,3,3-d3, >95% (HPLC), D–Serine–d3, D-Serine-d3, 96.36%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
(2R)-2-amino-2,3,3-trideuterio-3-hydroxypropanoic acid (CAS 1414348-52-9) is a chemical compound with the molecular formula C3H7NO3 and a molecular weight of 108.11 g/mol. IUPAC name: (2R)-2-amino-2,3,3-trideuterio-3-hydroxypropanoic acid. InChIKey: MTCFGRXMJLQNBG-MIRRBZTDSA-N.
| Molecular formula | C3H7NO3 |
|---|---|
| Molecular weight | 108.11 g/mol |
| IUPAC name | (2R)-2-amino-2,3,3-trideuterio-3-hydroxypropanoic acid |
| InChIKey | MTCFGRXMJLQNBG-MIRRBZTDSA-N |
| SMILES | [2H][C@](C(=O)O)(C([2H])([2H])O)N |
Computed by PubChem (NCBI)