CAS 59935-32-9 appears in our catalog under these names: L-Serine-15N, 98% 98atom%15N, L-Serine-15N, >95% (HPLC), L–Serine–15N, L-SERINE-15N, 98 ATOM % 15N, 98% (CP), L-Serine-15N, ≥98 atom% 15N,≥98%, ≥98 atom% 15N,≥98%. Offered by: AmBeed, TRC, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 250mg, 100mg, 10mg, 50mg, 25mg, 5mg, 500MG.
(2S)-2-(15N)azanyl-3-hydroxypropanoic acid (CAS 59935-32-9) is a chemical compound with the molecular formula C3H7NO3 and a molecular weight of 106.09 g/mol. IUPAC name: (2S)-2-(15N)azanyl-3-hydroxypropanoic acid. InChIKey: MTCFGRXMJLQNBG-GZPBOPPUSA-N.
| Molecular formula | C3H7NO3 |
|---|---|
| Molecular weight | 106.09 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-3-hydroxypropanoic acid |
| InChIKey | MTCFGRXMJLQNBG-GZPBOPPUSA-N |
| SMILES | C([C@@H](C(=O)O)[15NH2])O |
Computed by PubChem (NCBI)