CAS 105602-27-5 is the registry number for N-(1-(4-Aminophenyl)-3-methyl-1H-pyrazol-5-yl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 10g.
N-[2-(4-aminophenyl)-5-methylpyrazol-3-yl]acetamide (CAS 105602-27-5) is a chemical compound with the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. IUPAC name: N-[2-(4-aminophenyl)-5-methylpyrazol-3-yl]acetamide. InChIKey: MSRJKFLYRRZCJL-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O |
|---|---|
| Molecular weight | 230.27 g/mol |
| IUPAC name | N-[2-(4-aminophenyl)-5-methylpyrazol-3-yl]acetamide |
| InChIKey | MSRJKFLYRRZCJL-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)NC(=O)C)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)