Products 105608-07-9

CAS 105608-07-9 is the registry number for 2-[2-(1,3-dioxoisoindolin-2-yl)ethoxy]ethyl methanesulfonate, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethyl methanesulfonate (CAS 105608-07-9) is a chemical compound with the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. IUPAC name: 2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethyl methanesulfonate. InChIKey: DFATVAIOSVCLRN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO6S
Molecular weight313.33 g/mol
IUPAC name2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethyl methanesulfonate
InChIKeyDFATVAIOSVCLRN-UHFFFAOYSA-N
SMILESCS(=O)(=O)OCCOCCN1C(=O)C2=CC=CC=C2C1=O

Computed by PubChem (NCBI)