Products 1251925-44-6
CAS 1251925-44-6 is the registry number for 3-{(2-(4-Methanesulfonylphenyl)-2-oxoethyl)carbamoyl}propanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-[[2-(4-methylsulfonylphenyl)-2-oxoethyl]amino]-4-oxobutanoic acid (CAS 1251925-44-6) is a chemical compound with the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. IUPAC name: 4-[[2-(4-methylsulfonylphenyl)-2-oxoethyl]amino]-4-oxobutanoic acid. InChIKey: CRHUQDJXIUENJB-UHFFFAOYSA-N.
| Molecular formula | C13H15NO6S |
|---|---|
| Molecular weight | 313.33 g/mol |
| IUPAC name | 4-[[2-(4-methylsulfonylphenyl)-2-oxoethyl]amino]-4-oxobutanoic acid |
| InChIKey | CRHUQDJXIUENJB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(=O)CNC(=O)CCC(=O)O |
Computed by PubChem (NCBI)