Products 2293206-33-2

CAS 2293206-33-2 is the registry number for Florfenicol Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2-acetamido-3-(4-methylsulfonylphenyl)-3-oxopropanoate (CAS 2293206-33-2) is a chemical compound with the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. IUPAC name: methyl 2-acetamido-3-(4-methylsulfonylphenyl)-3-oxopropanoate. InChIKey: UPTYABSLRJPFSL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO6S
Molecular weight313.33 g/mol
IUPAC namemethyl 2-acetamido-3-(4-methylsulfonylphenyl)-3-oxopropanoate
InChIKeyUPTYABSLRJPFSL-UHFFFAOYSA-N
SMILESCC(=O)NC(C(=O)C1=CC=C(C=C1)S(=O)(=O)C)C(=O)OC

Computed by PubChem (NCBI)