CAS 2293206-33-2 is the registry number for Florfenicol Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-acetamido-3-(4-methylsulfonylphenyl)-3-oxopropanoate (CAS 2293206-33-2) is a chemical compound with the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. IUPAC name: methyl 2-acetamido-3-(4-methylsulfonylphenyl)-3-oxopropanoate. InChIKey: UPTYABSLRJPFSL-UHFFFAOYSA-N.
| Molecular formula | C13H15NO6S |
|---|---|
| Molecular weight | 313.33 g/mol |
| IUPAC name | methyl 2-acetamido-3-(4-methylsulfonylphenyl)-3-oxopropanoate |
| InChIKey | UPTYABSLRJPFSL-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C(=O)C1=CC=C(C=C1)S(=O)(=O)C)C(=O)OC |
Computed by PubChem (NCBI)