Products 120967-92-2
CAS 120967-92-2 appears in our catalog under these names: α–D–Galactopyranosylphenyl isothiocyanate, α-D-Galactopyranosyl phenylisothiocyanate, Alpha-d-galactopyranosylphenyl isothiocyanate, ≥98%, ≥98%, α-D-Galactopyranosylphenyl isothiocyanate. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 500μg, 2mg, 10mg, 50mg, 25mg, 25 mg.
(2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(4-isothiocyanatophenoxy)oxane-3,4,5-triol (CAS 120967-92-2) is a chemical compound with the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. IUPAC name: (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(4-isothiocyanatophenoxy)oxane-3,4,5-triol. InChIKey: RWANFUZQWINQBY-SJHCENCUSA-N.
| Molecular formula | C13H15NO6S |
|---|---|
| Molecular weight | 313.33 g/mol |
| IUPAC name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(4-isothiocyanatophenoxy)oxane-3,4,5-triol |
| InChIKey | RWANFUZQWINQBY-SJHCENCUSA-N |
| SMILES | C1=CC(=CC=C1N=C=S)O[C@@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)