Products 1056283-76-1
CAS 1056283-76-1 is the registry number for 10-(Propan-2-yl)-7-thia-9,11-diazatricyclo(6.4.0.0,2,6)dodeca-1(8),2(6),9-trien-12-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
10-propan-2-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (CAS 1056283-76-1) is a chemical compound with the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. IUPAC name: 10-propan-2-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one. InChIKey: FZCWAZGHGMQXAA-UHFFFAOYSA-N.
| Molecular formula | C12H14N2OS |
|---|---|
| Molecular weight | 234.32 g/mol |
| IUPAC name | 10-propan-2-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| InChIKey | FZCWAZGHGMQXAA-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC2=C(C3=C(S2)CCC3)C(=O)N1 |
Computed by PubChem (NCBI)