CAS 1056894-33-7 is the registry number for 3-Cinnolinemethanol. Offered by: TRC. Available pack sizes: 1g.
Cinnolin-3-ylmethanol (CAS 1056894-33-7) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: cinnolin-3-ylmethanol. InChIKey: VFVLNXYGKMNNEN-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | cinnolin-3-ylmethanol |
| InChIKey | VFVLNXYGKMNNEN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N=N2)CO |
Computed by PubChem (NCBI)