CAS 1057246-82-8 is the registry number for (R)-7-Methoxychroman-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-7-methoxy-3,4-dihydro-2H-chromen-4-amine (CAS 1057246-82-8) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (4R)-7-methoxy-3,4-dihydro-2H-chromen-4-amine. InChIKey: RKCMZVXMWWKKAH-SECBINFHSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (4R)-7-methoxy-3,4-dihydro-2H-chromen-4-amine |
| InChIKey | RKCMZVXMWWKKAH-SECBINFHSA-N |
| SMILES | COC1=CC2=C(C=C1)[C@@H](CCO2)N |
Computed by PubChem (NCBI)