Products 105807-84-9
CAS 105807-84-9 appears in our catalog under these names: 6-Amino-2,2-dimethyl-2h-benzo[b][1,4]oxazin-3(4h)-one, 95%, 6-Amino-2,2-dimethyl-2H-benzo(b)(1,4)oxazin-3(4h)one, >95% (HPLC), 6–Amino–2，2–dimethyl–4H–benzo(1，4)oxazin–3–one, 6-Amino-2,2-dimethyl-2H-benzo(b)(1,4)oxazin-3(4H)-one, 6-Amino-2,2-dimethyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 97%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Fluorochem. Available pack sizes: 100mg, 1g, 500mg, 50mg, 250mg, 5g.
6-amino-2,2-dimethyl-4H-1,4-benzoxazin-3-one (CAS 105807-84-9) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: 6-amino-2,2-dimethyl-4H-1,4-benzoxazin-3-one. InChIKey: SZYICLSWZHMIFL-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 6-amino-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
| InChIKey | SZYICLSWZHMIFL-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)C=CC(=C2)N)C |
Computed by PubChem (NCBI)