CAS 1058704-98-5 is the registry number for 8-Chloro-6-nitro-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-6-nitro-4H-1,4-benzoxazin-3-one (CAS 1058704-98-5) is a chemical compound with the molecular formula C8H5ClN2O4 and a molecular weight of 228.59 g/mol. IUPAC name: 8-chloro-6-nitro-4H-1,4-benzoxazin-3-one. InChIKey: VYNZRTPLAAHUHR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O4 |
|---|---|
| Molecular weight | 228.59 g/mol |
| IUPAC name | 8-chloro-6-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | VYNZRTPLAAHUHR-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C(=CC(=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)