CAS 1802660-24-7 is the registry number for 5-Chloro-7-nitro-2H-benzo[b][1,4]oxazin-3(4H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-7-nitro-4H-1,4-benzoxazin-3-one (CAS 1802660-24-7) is a chemical compound with the molecular formula C8H5ClN2O4 and a molecular weight of 228.59 g/mol. IUPAC name: 5-chloro-7-nitro-4H-1,4-benzoxazin-3-one. InChIKey: SMPWPMMIEIUUOX-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O4 |
|---|---|
| Molecular weight | 228.59 g/mol |
| IUPAC name | 5-chloro-7-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | SMPWPMMIEIUUOX-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=C(C=C2Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)