CAS 870064-73-6 appears in our catalog under these names: 6-Chloro-8-nitro-4h-benzo[1,4]oxazin-3-one, 95%, 6-Chloro-8-nitro-2H-benzo(b)(1,4)oxazin-3(4H)-one, 98%, 6-Chloro-8-nitro-4H-benzo(1,4)oxazin-3-one, 6-Chloro-8-Nitro-4H-Benzo[1,4]Oxazin-3-One, 98%, 98%, 6-Chloro-8-nitro-3,4-dihydro-2h-1,4-benzoxazin-3-one, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 0,5g, 250mg, 500mg.
6-chloro-8-nitro-4H-1,4-benzoxazin-3-one (CAS 870064-73-6) is a chemical compound with the molecular formula C8H5ClN2O4 and a molecular weight of 228.59 g/mol. IUPAC name: 6-chloro-8-nitro-4H-1,4-benzoxazin-3-one. InChIKey: PHVYJBIAHFOQLG-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O4 |
|---|---|
| Molecular weight | 228.59 g/mol |
| IUPAC name | 6-chloro-8-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | PHVYJBIAHFOQLG-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C(=CC(=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)