CAS 116862-22-7 appears in our catalog under these names: 6-Chloro-7-nitro-2h-1,4-benzoxazin-3(4h)-one, 95%, 6-Chloro-7-nitro-2H-1,4-benzoxazin-3(4H)-one, 6-Chloro-7-nitro-2H-1,4-benzoxazin-3(4H)-one, 97%, 97%, 6-Chloro-7-nitro-2H-benzo[b][1,4]oxazin-3(4H)-one, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg.
6-chloro-7-nitro-4H-1,4-benzoxazin-3-one (CAS 116862-22-7) is a chemical compound with the molecular formula C8H5ClN2O4 and a molecular weight of 228.59 g/mol. IUPAC name: 6-chloro-7-nitro-4H-1,4-benzoxazin-3-one. InChIKey: XTFDVLNZVNSPIA-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O4 |
|---|---|
| Molecular weight | 228.59 g/mol |
| IUPAC name | 6-chloro-7-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | XTFDVLNZVNSPIA-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC(=C(C=C2O1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)