Products 105895-93-0

CAS 105895-93-0 is the registry number for 2-[(3-Cyano-propyl)-(toluene-4-sulfonyl)-amino]-benzoic acid methyl ester, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-[3-cyanopropyl-(4-methylphenyl)sulfonylamino]benzoate (CAS 105895-93-0) is a chemical compound with the molecular formula C19H20N2O4S and a molecular weight of 372.4 g/mol. IUPAC name: methyl 2-[3-cyanopropyl-(4-methylphenyl)sulfonylamino]benzoate. InChIKey: YWWABXVTNCTBPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC19H20N2O4S
Molecular weight372.4 g/mol
IUPAC namemethyl 2-[3-cyanopropyl-(4-methylphenyl)sulfonylamino]benzoate
InChIKeyYWWABXVTNCTBPZ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)N(CCCC#N)C2=CC=CC=C2C(=O)OC

Computed by PubChem (NCBI)