CAS 159734-23-3 is the registry number for N,N,O-Tridesmethyl Diltiazem. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,3S)-5-(2-aminoethyl)-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate (CAS 159734-23-3) is a chemical compound with the molecular formula C19H20N2O4S and a molecular weight of 372.4 g/mol. IUPAC name: [(2S,3S)-5-(2-aminoethyl)-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate. InChIKey: HLUHIUIPTZZNFN-MSOLQXFVSA-N.
| Molecular formula | C19H20N2O4S |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | [(2S,3S)-5-(2-aminoethyl)-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate |
| InChIKey | HLUHIUIPTZZNFN-MSOLQXFVSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](SC2=CC=CC=C2N(C1=O)CCN)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)