CAS 1803570-77-5 is the registry number for Benzyl 3-(2,3-dihydro-1H-indole-1-sulfonyl)azetidine-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Benzyl 3-(2,3-dihydroindol-1-ylsulfonyl)azetidine-1-carboxylate (CAS 1803570-77-5) is a chemical compound with the molecular formula C19H20N2O4S and a molecular weight of 372.4 g/mol. IUPAC name: benzyl 3-(2,3-dihydroindol-1-ylsulfonyl)azetidine-1-carboxylate. InChIKey: WBFASVBETJDPKO-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O4S |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | benzyl 3-(2,3-dihydroindol-1-ylsulfonyl)azetidine-1-carboxylate |
| InChIKey | WBFASVBETJDPKO-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)S(=O)(=O)C3CN(C3)C(=O)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)