CAS 625853-74-9 appears in our catalog under these names: Pioglitazone EP Impurity A, Pioglitazone Impurity 8(Pioglitazone EP Impurity A), 5-Hydroxy pioglitazone, 5-(4-(2-(5-Ethylpyridin-2-yl)ethoxy)benzyl)-5-hydroxythiazolidine-2,4-dione, 97%, 97%. Offered by: Chemat Brand, Hubei YoungXin, Biosynth, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-5-hydroxy-1,3-thiazolidine-2,4-dione (CAS 625853-74-9) is a chemical compound with the molecular formula C19H20N2O4S and a molecular weight of 372.4 g/mol. IUPAC name: 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-5-hydroxy-1,3-thiazolidine-2,4-dione. InChIKey: HDKWBDGQTUQSTO-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O4S |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-5-hydroxy-1,3-thiazolidine-2,4-dione |
| InChIKey | HDKWBDGQTUQSTO-UHFFFAOYSA-N |
| SMILES | CCC1=CN=C(C=C1)CCOC2=CC=C(C=C2)CC3(C(=O)NC(=O)S3)O |
Computed by PubChem (NCBI)