CAS 105902-32-7 is the registry number for 2-Methyl-5-phenylphenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-methyl-5-phenylphenol (CAS 105902-32-7) is a chemical compound with the molecular formula C13H12O and a molecular weight of 184.23 g/mol. IUPAC name: 2-methyl-5-phenylphenol. InChIKey: CAPGYRYSLXORFK-UHFFFAOYSA-N.
| Molecular formula | C13H12O |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | 2-methyl-5-phenylphenol |
| InChIKey | CAPGYRYSLXORFK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)