Products 1401102-93-9
CAS 1401102-93-9 is the registry number for methyl 1-(4-formylphenyl)azetidine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 1-(4-formylphenyl)azetidine-3-carboxylate (CAS 1401102-93-9) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: methyl 1-(4-formylphenyl)azetidine-3-carboxylate. InChIKey: VLIMBCMXHJLGOO-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | methyl 1-(4-formylphenyl)azetidine-3-carboxylate |
| InChIKey | VLIMBCMXHJLGOO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CN(C1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)