Products 1059536-36-5
CAS 1059536-36-5 appears in our catalog under these names: 1-(3-Bromophenyl)piperidine-4-carboxylic acid, 95%, 1-(3-Bromophenyl)piperidine-4-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
1-(3-bromophenyl)piperidine-4-carboxylic acid (CAS 1059536-36-5) is a chemical compound with the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. IUPAC name: 1-(3-bromophenyl)piperidine-4-carboxylic acid. InChIKey: SEZDIKBWBKCELD-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | 1-(3-bromophenyl)piperidine-4-carboxylic acid |
| InChIKey | SEZDIKBWBKCELD-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)