CAS 1059700-17-2 appears in our catalog under these names: 3-Methyl-3,6-diazabicyclo(3.1.1)heptane bis(trifluoroacetic acid), 3-Methyl-3,6-diazabicyclo[3.1.1]heptane bis(trifluoroacetic acid), 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 2,5g, 250mg, 100mg, 1g, 5g, 10g, 25g.
3-methyl-3,6-diazabicyclo[3.1.1]heptane;bis(2,2,2-trifluoroacetic acid) (CAS 1059700-17-2) is a chemical compound with the molecular formula C10H14F6N2O4 and a molecular weight of 340.22 g/mol. IUPAC name: 3-methyl-3,6-diazabicyclo[3.1.1]heptane;bis(2,2,2-trifluoroacetic acid). InChIKey: NPGQVJMJWYAVNA-UHFFFAOYSA-N.
| Molecular formula | C10H14F6N2O4 |
|---|---|
| Molecular weight | 340.22 g/mol |
| IUPAC name | 3-methyl-3,6-diazabicyclo[3.1.1]heptane;bis(2,2,2-trifluoroacetic acid) |
| InChIKey | NPGQVJMJWYAVNA-UHFFFAOYSA-N |
| SMILES | CN1CC2CC(C1)N2.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)