CAS 2840774-02-7 appears in our catalog under these names: 6-Methyl-2,6-diazabicyclo(3.2.0)heptane bis(2,2,2-trifluoroacetate), 97%, 6-methyl-2,6-diazabicyclo[3.2.0]heptane,bis(2,2,2-trifluoroacetic acid), 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg.
6-methyl-2,6-diazabicyclo[3.2.0]heptane;bis(2,2,2-trifluoroacetic acid) (CAS 2840774-02-7) is a chemical compound with the molecular formula C10H14F6N2O4 and a molecular weight of 340.22 g/mol. IUPAC name: 6-methyl-2,6-diazabicyclo[3.2.0]heptane;bis(2,2,2-trifluoroacetic acid). InChIKey: IGEOCHDFEBSENG-UHFFFAOYSA-N.
| Molecular formula | C10H14F6N2O4 |
|---|---|
| Molecular weight | 340.22 g/mol |
| IUPAC name | 6-methyl-2,6-diazabicyclo[3.2.0]heptane;bis(2,2,2-trifluoroacetic acid) |
| InChIKey | IGEOCHDFEBSENG-UHFFFAOYSA-N |
| SMILES | CN1CC2C1CCN2.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)