CAS 2173052-54-3 appears in our catalog under these names: (1R,5S)-6-Methyl-3,6-diazabicyclo[3.2.0]heptane bis(trifluoroacetic acid), 95%, (1R,5S)-6-methyl-3,6-diazabicyclo(3.2.0)heptane, bis(trifluoroacetic acid), 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 10g.
(1R,5S)-6-methyl-3,6-diazabicyclo[3.2.0]heptane;bis(2,2,2-trifluoroacetic acid) (CAS 2173052-54-3) is a chemical compound with the molecular formula C10H14F6N2O4 and a molecular weight of 340.22 g/mol. IUPAC name: (1R,5S)-6-methyl-3,6-diazabicyclo[3.2.0]heptane;bis(2,2,2-trifluoroacetic acid). InChIKey: RVYFZXHWFYQQDK-BNTLRKBRSA-N.
| Molecular formula | C10H14F6N2O4 |
|---|---|
| Molecular weight | 340.22 g/mol |
| IUPAC name | (1R,5S)-6-methyl-3,6-diazabicyclo[3.2.0]heptane;bis(2,2,2-trifluoroacetic acid) |
| InChIKey | RVYFZXHWFYQQDK-BNTLRKBRSA-N |
| SMILES | CN1C[C@@H]2[C@H]1CNC2.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)