CAS 2068138-20-3 is the registry number for (1S,5R)-6-Methyl-3,6-diazabicyclo(3.2.0)heptane bis(2,2,2-trifluoroacetate), 97%. Offered by: AmBeed. Available pack sizes: 10g.
(1S,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptane;bis(2,2,2-trifluoroacetic acid) (CAS 2068138-20-3) is a chemical compound with the molecular formula C10H14F6N2O4 and a molecular weight of 340.22 g/mol. IUPAC name: (1S,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptane;bis(2,2,2-trifluoroacetic acid). InChIKey: RVYFZXHWFYQQDK-USPAICOZSA-N.
| Molecular formula | C10H14F6N2O4 |
|---|---|
| Molecular weight | 340.22 g/mol |
| IUPAC name | (1S,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptane;bis(2,2,2-trifluoroacetic acid) |
| InChIKey | RVYFZXHWFYQQDK-USPAICOZSA-N |
| SMILES | CN1C[C@H]2[C@@H]1CNC2.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)