Products 1707391-49-8
CAS 1707391-49-8 is the registry number for tert-Butyl 3-bromo-2-propionyl-1H-indole-1-carboxylate. Offered by: Biosynth. Available pack sizes: 5000mg.
Tert-butyl 3-bromo-2-propanoylindole-1-carboxylate (CAS 1707391-49-8) is a chemical compound with the molecular formula C16H18BrNO3 and a molecular weight of 352.22 g/mol. IUPAC name: tert-butyl 3-bromo-2-propanoylindole-1-carboxylate. InChIKey: TYIAQXVSIVSTET-UHFFFAOYSA-N.
| Molecular formula | C16H18BrNO3 |
|---|---|
| Molecular weight | 352.22 g/mol |
| IUPAC name | tert-butyl 3-bromo-2-propanoylindole-1-carboxylate |
| InChIKey | TYIAQXVSIVSTET-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C2=CC=CC=C2N1C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)