CAS 106047-32-9 appears in our catalog under these names: 4,2':5',4''-Terpyridine, 97%, 97%, 2,5-Bis(pyrid-4-yl)pyridine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,5-dipyridin-4-ylpyridine (CAS 106047-32-9) is a chemical compound with the molecular formula C15H11N3 and a molecular weight of 233.27 g/mol. IUPAC name: 2,5-dipyridin-4-ylpyridine. InChIKey: GXKXLCXXYGWDOJ-UHFFFAOYSA-N.
| Molecular formula | C15H11N3 |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | 2,5-dipyridin-4-ylpyridine |
| InChIKey | GXKXLCXXYGWDOJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C2=CC=NC=C2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)