Products 1060801-06-0

CAS 1060801-06-0 appears in our catalog under these names: 2-Cyanopyridine-3-sulfonyl chloride, 95%, 2-Cyanopyridine-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2-cyanopyridine-3-sulfonyl chloride (CAS 1060801-06-0) is a chemical compound with the molecular formula C6H3ClN2O2S and a molecular weight of 202.62 g/mol. IUPAC name: 2-cyanopyridine-3-sulfonyl chloride. InChIKey: QZSSOVKSSCLNSM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3ClN2O2S
Molecular weight202.62 g/mol
IUPAC name2-cyanopyridine-3-sulfonyl chloride
InChIKeyQZSSOVKSSCLNSM-UHFFFAOYSA-N
SMILESC1=CC(=C(N=C1)C#N)S(=O)(=O)Cl

Computed by PubChem (NCBI)