CAS 1060804-15-0 appears in our catalog under these names: 5-Cyanopyridine-3-sulfonyl chloride, 5-Cyanopyridine-3-sulfonyl chloride, 98%, 98%, 5-CYANOPYRIDINE-3-SULFONYL CHLORIDE, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg, 1g.
5-cyanopyridine-3-sulfonyl chloride (CAS 1060804-15-0) is a chemical compound with the molecular formula C6H3ClN2O2S and a molecular weight of 202.62 g/mol. IUPAC name: 5-cyanopyridine-3-sulfonyl chloride. InChIKey: RZNCBFTUKKMELY-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O2S |
|---|---|
| Molecular weight | 202.62 g/mol |
| IUPAC name | 5-cyanopyridine-3-sulfonyl chloride |
| InChIKey | RZNCBFTUKKMELY-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1S(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)