Products 1060804-15-0

CAS 1060804-15-0 appears in our catalog under these names: 5-Cyanopyridine-3-sulfonyl chloride, 5-Cyanopyridine-3-sulfonyl chloride, 98%, 98%, 5-CYANOPYRIDINE-3-SULFONYL CHLORIDE, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-cyanopyridine-3-sulfonyl chloride (CAS 1060804-15-0) is a chemical compound with the molecular formula C6H3ClN2O2S and a molecular weight of 202.62 g/mol. IUPAC name: 5-cyanopyridine-3-sulfonyl chloride. InChIKey: RZNCBFTUKKMELY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3ClN2O2S
Molecular weight202.62 g/mol
IUPAC name5-cyanopyridine-3-sulfonyl chloride
InChIKeyRZNCBFTUKKMELY-UHFFFAOYSA-N
SMILESC1=C(C=NC=C1S(=O)(=O)Cl)C#N

Computed by PubChem (NCBI)