Products 2891724-93-7
CAS 2891724-93-7 is the registry number for 2-(2-Chlorothiazol-4-yl)-2-cyanoacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-chloro-1,3-thiazol-4-yl)-2-cyanoacetic acid (CAS 2891724-93-7) is a chemical compound with the molecular formula C6H3ClN2O2S and a molecular weight of 202.62 g/mol. IUPAC name: 2-(2-chloro-1,3-thiazol-4-yl)-2-cyanoacetic acid. InChIKey: ZBNMNLJERQVJLJ-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O2S |
|---|---|
| Molecular weight | 202.62 g/mol |
| IUPAC name | 2-(2-chloro-1,3-thiazol-4-yl)-2-cyanoacetic acid |
| InChIKey | ZBNMNLJERQVJLJ-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)Cl)C(C#N)C(=O)O |
Computed by PubChem (NCBI)