Products 1249854-80-5

CAS 1249854-80-5 appears in our catalog under these names: 3-Cyanopyridine-2-sulfonyl chloride, 96%, 3-Cyanopyridine-2-sulfonyl chloride, 97%, 3-Cyanopyridine-2-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,25g, 0,5g, 2g.

Structural formula: {0} (CAS {1})

3-cyanopyridine-2-sulfonyl chloride (CAS 1249854-80-5) is a chemical compound with the molecular formula C6H3ClN2O2S and a molecular weight of 202.62 g/mol. IUPAC name: 3-cyanopyridine-2-sulfonyl chloride. InChIKey: MAAJHNYCTLCBBS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3ClN2O2S
Molecular weight202.62 g/mol
IUPAC name3-cyanopyridine-2-sulfonyl chloride
InChIKeyMAAJHNYCTLCBBS-UHFFFAOYSA-N
SMILESC1=CC(=C(N=C1)S(=O)(=O)Cl)C#N

Computed by PubChem (NCBI)