CAS 1557475-82-7 is the registry number for 5-Chloroimidazo(2,1-b)(1,3)thiazole-6-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-chloroimidazo[2,1-b][1,3]thiazole-6-carboxylic acid (CAS 1557475-82-7) is a chemical compound with the molecular formula C6H3ClN2O2S and a molecular weight of 202.62 g/mol. IUPAC name: 5-chloroimidazo[2,1-b][1,3]thiazole-6-carboxylic acid. InChIKey: CVBJZSGXEFKQNP-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O2S |
|---|---|
| Molecular weight | 202.62 g/mol |
| IUPAC name | 5-chloroimidazo[2,1-b][1,3]thiazole-6-carboxylic acid |
| InChIKey | CVBJZSGXEFKQNP-UHFFFAOYSA-N |
| SMILES | C1=CSC2=NC(=C(N21)Cl)C(=O)O |
Computed by PubChem (NCBI)