CAS 1060802-03-0 is the registry number for 3-(Trifluoromethyl)pyridine-5-sulfonyl chloride. Offered by: Fluorochem. Available pack sizes: 250mg.
5-(trifluoromethyl)pyridine-3-sulfonyl chloride (CAS 1060802-03-0) is a chemical compound with the molecular formula C6H3ClF3NO2S and a molecular weight of 245.61 g/mol. IUPAC name: 5-(trifluoromethyl)pyridine-3-sulfonyl chloride. InChIKey: RUURWHCYTYUNCM-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3NO2S |
|---|---|
| Molecular weight | 245.61 g/mol |
| IUPAC name | 5-(trifluoromethyl)pyridine-3-sulfonyl chloride |
| InChIKey | RUURWHCYTYUNCM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1S(=O)(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)