Products 533932-27-3
CAS 533932-27-3 appears in our catalog under these names: 4-(Trifluoromethyl)pyridine-3-sulfonyl chloride, 4-(Trifluoromethyl)pyridine-3-sulfonyl chloride, 95%. Offered by: Fluorochem, AmBeed. Available pack sizes: 250mg, 1g.
4-(trifluoromethyl)pyridine-3-sulfonyl chloride (CAS 533932-27-3) is a chemical compound with the molecular formula C6H3ClF3NO2S and a molecular weight of 245.61 g/mol. IUPAC name: 4-(trifluoromethyl)pyridine-3-sulfonyl chloride. InChIKey: VFJOQYGYBJRSJF-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3NO2S |
|---|---|
| Molecular weight | 245.61 g/mol |
| IUPAC name | 4-(trifluoromethyl)pyridine-3-sulfonyl chloride |
| InChIKey | VFJOQYGYBJRSJF-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)