Products 1060811-16-6

CAS 1060811-16-6 appears in our catalog under these names: 2-(Trifluoromethyl)-3-pyridinesulfonyl chloride, 95%, 2-(Trifluoromethyl)-3-pyridinesulfonyl chloride, 97%, 2-(Trifluoromethyl)pyridine-3-sulfonyl Chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(trifluoromethyl)pyridine-3-sulfonyl chloride (CAS 1060811-16-6) is a chemical compound with the molecular formula C6H3ClF3NO2S and a molecular weight of 245.61 g/mol. IUPAC name: 2-(trifluoromethyl)pyridine-3-sulfonyl chloride. InChIKey: IRINAFUPYRWEKL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3ClF3NO2S
Molecular weight245.61 g/mol
IUPAC name2-(trifluoromethyl)pyridine-3-sulfonyl chloride
InChIKeyIRINAFUPYRWEKL-UHFFFAOYSA-N
SMILESC1=CC(=C(N=C1)C(F)(F)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)