CAS 1060811-16-6 appears in our catalog under these names: 2-(Trifluoromethyl)-3-pyridinesulfonyl chloride, 95%, 2-(Trifluoromethyl)-3-pyridinesulfonyl chloride, 97%, 2-(Trifluoromethyl)pyridine-3-sulfonyl Chloride, 2-(Trifluoromethyl)pyridine-3-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-(trifluoromethyl)pyridine-3-sulfonyl chloride (CAS 1060811-16-6) is a chemical compound with the molecular formula C6H3ClF3NO2S and a molecular weight of 245.61 g/mol. IUPAC name: 2-(trifluoromethyl)pyridine-3-sulfonyl chloride. InChIKey: IRINAFUPYRWEKL-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3NO2S |
|---|---|
| Molecular weight | 245.61 g/mol |
| IUPAC name | 2-(trifluoromethyl)pyridine-3-sulfonyl chloride |
| InChIKey | IRINAFUPYRWEKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)