CAS 174485-72-4 appears in our catalog under these names: 5-Trifluoromethyl-2-pyridinesulfonyl Chloride, 95%, 10% in Benzene, 5-Trifluoromethyl-2-pyridinesulfonyl Chloride, 95%, 10% in Cyclohexane, 5-Trifluoromethyl-2-pyridinesulfonyl Chloride 95%, 5-(Trifluoromethyl)pyridine-2-sulfonyl chloride, 95%. Offered by: TRC, Ambeed, Fluorochem. Available pack sizes: 10ml, 1ml, 100mg, 250mg, 1g.
5-(trifluoromethyl)pyridine-2-sulfonyl chloride (CAS 174485-72-4) is a chemical compound with the molecular formula C6H3ClF3NO2S and a molecular weight of 245.61 g/mol. IUPAC name: 5-(trifluoromethyl)pyridine-2-sulfonyl chloride. InChIKey: MRIFFPWOMKLYKZ-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3NO2S |
|---|---|
| Molecular weight | 245.61 g/mol |
| IUPAC name | 5-(trifluoromethyl)pyridine-2-sulfonyl chloride |
| InChIKey | MRIFFPWOMKLYKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)