Products 1060810-89-0
CAS 1060810-89-0 is the registry number for 1-(2-Chloro-6-(trifluoromethyl)pyridin-4-yl)ethanone, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
1-[2-chloro-6-(trifluoromethyl)-4-pyridinyl]ethanone (CAS 1060810-89-0) is a chemical compound with the molecular formula C8H5ClF3NO and a molecular weight of 223.58 g/mol. IUPAC name: 1-[2-chloro-6-(trifluoromethyl)-4-pyridinyl]ethanone. InChIKey: LXJOBCVOPIXNJH-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO |
|---|---|
| Molecular weight | 223.58 g/mol |
| IUPAC name | 1-[2-chloro-6-(trifluoromethyl)-4-pyridinyl]ethanone |
| InChIKey | LXJOBCVOPIXNJH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=NC(=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)