CAS 1060816-19-4 appears in our catalog under these names: 2-Bromo-4-phenyloxazole, 95+%, 2-Bromo-4-phenyl-1,3-oxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg.
2-bromo-4-phenyl-1,3-oxazole (CAS 1060816-19-4) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 2-bromo-4-phenyl-1,3-oxazole. InChIKey: PZEVPGXTKPDMGD-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 2-bromo-4-phenyl-1,3-oxazole |
| InChIKey | PZEVPGXTKPDMGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=COC(=N2)Br |
Computed by PubChem (NCBI)