CAS 1060817-06-2 is the registry number for 2-(2-Pyrazin-2-yl-1,3-thiazol-4-yl)ethanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(2-pyrazin-2-yl-1,3-thiazol-4-yl)ethanamine (CAS 1060817-06-2) is a chemical compound with the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. IUPAC name: 2-(2-pyrazin-2-yl-1,3-thiazol-4-yl)ethanamine. InChIKey: FOWBCLPVGCFPKY-UHFFFAOYSA-N.
| Molecular formula | C9H10N4S |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 2-(2-pyrazin-2-yl-1,3-thiazol-4-yl)ethanamine |
| InChIKey | FOWBCLPVGCFPKY-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C2=NC(=CS2)CCN |
Computed by PubChem (NCBI)