Products 117411-02-6
CAS 117411-02-6 appears in our catalog under these names: 4-Amino-6-phenyl-1,6-dihydro-1,3,5-triazine-2-thiol, 95%, 4-Amino-6-phenyl-1,6-dihydro-1,3,5-triazine-2-thiol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-amino-2-phenyl-2,5-dihydro-1H-1,3,5-triazine-6-thione (CAS 117411-02-6) is a chemical compound with the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. IUPAC name: 4-amino-2-phenyl-2,5-dihydro-1H-1,3,5-triazine-6-thione. InChIKey: KNCPIPXWOPQHLR-UHFFFAOYSA-N.
| Molecular formula | C9H10N4S |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 4-amino-2-phenyl-2,5-dihydro-1H-1,3,5-triazine-6-thione |
| InChIKey | KNCPIPXWOPQHLR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2NC(=S)NC(=N2)N |
Computed by PubChem (NCBI)