CAS 3922-47-2 appears in our catalog under these names: 3-(Benzylsulfanyl)-1h-1,2,4-triazol-5-ylamine, 95%, 3-(Benzylthio)-1H-1,2,4-triazol-5-amine, 95%, 95%, 3-(benzylthio)-1H-1,2,4-triazol-5-amine, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
3-benzylsulfanyl-1H-1,2,4-triazol-5-amine (CAS 3922-47-2) is a chemical compound with the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. IUPAC name: 3-benzylsulfanyl-1H-1,2,4-triazol-5-amine. InChIKey: NQJATJCXKYZVEL-UHFFFAOYSA-N.
| Molecular formula | C9H10N4S |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 3-benzylsulfanyl-1H-1,2,4-triazol-5-amine |
| InChIKey | NQJATJCXKYZVEL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NNC(=N2)N |
Computed by PubChem (NCBI)