CAS 13373-10-9 appears in our catalog under these names: 4-Amino-5-benzyl-4h-1,2,4-triazole-3-thiol, 95%, 4–AMINO–5–BENZYL–4H–1,2,4–TRIAZOL–3–YL HYDROSULFIDE, 4-amino-3-benzyl-4,5-dihydro-1H-1,2,4-triazole-5-thione, 95+%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 500mg, 2.5g, 5g, 10g.
4-amino-3-benzyl-1H-1,2,4-triazole-5-thione (CAS 13373-10-9) is a chemical compound with the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. IUPAC name: 4-amino-3-benzyl-1H-1,2,4-triazole-5-thione. InChIKey: BQNXPJGHKISKRZ-UHFFFAOYSA-N.
| Molecular formula | C9H10N4S |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 4-amino-3-benzyl-1H-1,2,4-triazole-5-thione |
| InChIKey | BQNXPJGHKISKRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NNC(=S)N2N |
Computed by PubChem (NCBI)