CAS 1061358-40-4 is the registry number for 4-Amino-3-methoxy-n,n-dimethylbenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-amino-3-methoxy-N,N-dimethylbenzamide (CAS 1061358-40-4) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 4-amino-3-methoxy-N,N-dimethylbenzamide. InChIKey: PJKKOUHPNPDYBG-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 4-amino-3-methoxy-N,N-dimethylbenzamide |
| InChIKey | PJKKOUHPNPDYBG-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=C(C=C1)N)OC |
Computed by PubChem (NCBI)